CAS 69241-18-5 appears in our catalog under these names: Rel-(1R,2R)-2-phenylcyclobutan-1-amine hydrochloride, 98%, rac-(1R,2R)-2-Phenylcyclobutan-1-amine hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
Cis-(1R,2R)-2-phenylcyclobutan-1-amine;hydrochloride (CAS 69241-18-5) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: cis-(1R,2R)-2-phenylcyclobutan-1-amine;hydrochloride. InChIKey: XRWXBXHIAUZHMB-DHTOPLTISA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | cis-(1R,2R)-2-phenylcyclobutan-1-amine;hydrochloride |
| InChIKey | XRWXBXHIAUZHMB-DHTOPLTISA-N |
| SMILES | C1C[C@H]([C@H]1C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)