CAS 50786-34-0 is the registry number for 2-Methylpyrido[3,2-d]pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylpyrido[3,2-d]pyrimidin-4-amine (CAS 50786-34-0) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 2-methylpyrido[3,2-d]pyrimidin-4-amine. InChIKey: NNXNZQALEOQVEW-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 2-methylpyrido[3,2-d]pyrimidin-4-amine |
| InChIKey | NNXNZQALEOQVEW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)N)N=CC=C2 |
Computed by PubChem (NCBI)