CAS 50849-50-8 appears in our catalog under these names: 4-tert-Butyl-2-[(1z)-(hydroxyimino)methyl]phenol, 95%, 5-(tert-butyl)-2-hydroxybenzenecarbaldehyde oxime, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g.
4-tert-butyl-2-(hydroxyiminomethyl)phenol (CAS 50849-50-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 4-tert-butyl-2-(hydroxyiminomethyl)phenol. InChIKey: JPVAJIHITBSSAM-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-tert-butyl-2-(hydroxyiminomethyl)phenol |
| InChIKey | JPVAJIHITBSSAM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)O)C=NO |
Computed by PubChem (NCBI)