CAS 50884-83-8 is the registry number for (±)-Benzylphenobarbital. Offered by: TRC. Available pack sizes: 100mg.
1-benzyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione (CAS 50884-83-8) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: 1-benzyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione. InChIKey: DZVQJRKACDFACI-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 1-benzyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| InChIKey | DZVQJRKACDFACI-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)NC(=O)N(C1=O)CC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)