CAS 50921-37-4 appears in our catalog under these names: 1–(4–Methoxyphenyl)cyclobutanecarboxylic acid, 1-(4-Methoxyphenyl)cyclobutane-1-carboxylic acid, 1-(4-Methoxyphenyl)cyclobutanecarboxylic Acid, 98+%, 98+%, 1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid, 95%, 1-(4-Methoxyphenyl)cyclobutane-1-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 500mg, 5g.
1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid (CAS 50921-37-4) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid. InChIKey: FKPWMQWXYOZELT-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid |
| InChIKey | FKPWMQWXYOZELT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(CCC2)C(=O)O |
Computed by PubChem (NCBI)