CAS 50987-58-1 appears in our catalog under these names: 7–Chloronaphthalen–1–amine, 7-Chloronaphthalen-1-amine 95%, 7-Chloronaphthalen-1-amine, 98%, 7-Chloronaphthalen-1-amine, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.
7-chloronaphthalen-1-amine (CAS 50987-58-1) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 7-chloronaphthalen-1-amine. InChIKey: WKZOHSFHDCWFRP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 7-chloronaphthalen-1-amine |
| InChIKey | WKZOHSFHDCWFRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Cl)C(=C1)N |
Computed by PubChem (NCBI)