CAS 51009-73-5 is the registry number for 3-Chloro-5-nitrobenzene-1,2-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-chloro-5-nitrobenzene-1,2-diamine (CAS 51009-73-5) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: 3-chloro-5-nitrobenzene-1,2-diamine. InChIKey: VSKRLWVUULXUMF-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 3-chloro-5-nitrobenzene-1,2-diamine |
| InChIKey | VSKRLWVUULXUMF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)