CAS 51011-27-9 is the registry number for 4-(3,5-Dimethyl-1H-pyrazol-1-yl)phenol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(3,5-dimethylpyrazol-1-yl)phenol (CAS 51011-27-9) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)phenol. InChIKey: JZZQDUBNKXYQED-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 4-(3,5-dimethylpyrazol-1-yl)phenol |
| InChIKey | JZZQDUBNKXYQED-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)O)C |
Computed by PubChem (NCBI)