Products 51036-98-7
CAS 51036-98-7 appears in our catalog under these names: 4-(3,4-Dimethylphenyl)-4-oxobutyric acid, 95%, 4-(3,4-Dimethylphenyl)-4-oxobutanoic acid, 95+%, 4-(3,4-Dimethyl-phenyl)-4-oxo-butyric acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 0,5g.
4-(3,4-dimethylphenyl)-4-oxobutanoic acid (CAS 51036-98-7) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)-4-oxobutanoic acid. InChIKey: UXIHUHNPOHTZAQ-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 4-(3,4-dimethylphenyl)-4-oxobutanoic acid |
| InChIKey | UXIHUHNPOHTZAQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)CCC(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
4-(3,4-Dimethylphenyl)-4-oxobutanoic acid, 4-(3,4-Dimethylphenyl)-4-oxobutyric acid, 4-(3,4-Dimethyl-phenyl)-4-oxo-butyric acid, UXIHUHNPOHTZAQ-UHFFFAOYSA-N, 3-(3,4-Dimethylbenzoyl)propionic acid, 4-(3,4-dimethylphenyl)-4-oxo-butanoic acid, 4-(3,4-Dimethylphenyl)-4-oxobutanoic acid #, Benzenebutanoic acid, 3,4-dimethyl-.gamma.-oxo-