Products 510771-54-7
CAS 510771-54-7 is the registry number for 3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-5-(TRIFLUOROMETHYL)ANILINE, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)aniline (CAS 510771-54-7) is a chemical compound with the molecular formula C13H17BF3NO2 and a molecular weight of 287.09 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)aniline. InChIKey: MBZAVZRGXBFAPQ-UHFFFAOYSA-N.
| Molecular formula | C13H17BF3NO2 |
|---|---|
| Molecular weight | 287.09 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)aniline |
| InChIKey | MBZAVZRGXBFAPQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)