Products 51085-71-3
CAS 51085-71-3 is the registry number for Levodopa Impurity 6 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5,6-dihydroxy-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride (CAS 51085-71-3) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: (2S)-5,6-dihydroxy-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride. InChIKey: KVIKBBNWQWDBEO-RGMNGODLSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | (2S)-5,6-dihydroxy-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride |
| InChIKey | KVIKBBNWQWDBEO-RGMNGODLSA-N |
| SMILES | C1[C@H](NC2=CC(=C(C=C21)O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)