Products 51096-08-3
CAS 51096-08-3 is the registry number for (1S,2S)-Cyclohex-4-ene-1,2-dicarboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S,2S)-cyclohex-4-ene-1,2-dicarboxylic acid (CAS 51096-08-3) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: (1S,2S)-cyclohex-4-ene-1,2-dicarboxylic acid. InChIKey: ILUAAIDVFMVTAU-WDSKDSINSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | (1S,2S)-cyclohex-4-ene-1,2-dicarboxylic acid |
| InChIKey | ILUAAIDVFMVTAU-WDSKDSINSA-N |
| SMILES | C1C=CC[C@@H]([C@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)