Products 66036-31-5
CAS 66036-31-5 is the registry number for trans-Phenothrin. Offered by: MedChemExpress. Available pack sizes: Get quote.
Cis-(3-phenoxyphenyl)methyl (1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (CAS 66036-31-5) is a chemical compound with the molecular formula C23H26O3 and a molecular weight of 350.4 g/mol. IUPAC name: cis-(3-phenoxyphenyl)methyl (1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate. InChIKey: SBNFWQZLDJGRLK-LEWJYISDSA-N.
| Molecular formula | C23H26O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | cis-(3-phenoxyphenyl)methyl (1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | SBNFWQZLDJGRLK-LEWJYISDSA-N |
| SMILES | CC(=C[C@H]1[C@@H](C1(C)C)C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C |
Computed by PubChem (NCBI)