CAS 51390-14-8 is the registry number for 2-Sec-butyl-4-tert-butylphenol. Offered by: Biosynth. Available pack sizes: 5g.
2-butan-2-yl-4-tert-butylphenol (CAS 51390-14-8) is a chemical compound with the molecular formula C14H22O and a molecular weight of 206.32 g/mol. IUPAC name: 2-butan-2-yl-4-tert-butylphenol. InChIKey: JKFZLMPBXBMSPD-UHFFFAOYSA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 206.32 g/mol |
| IUPAC name | 2-butan-2-yl-4-tert-butylphenol |
| InChIKey | JKFZLMPBXBMSPD-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=C(C=CC(=C1)C(C)(C)C)O |
Computed by PubChem (NCBI)