CAS 51420-71-4 appears in our catalog under these names: 5,7-Dimethyl-1,8-naphthyridin-2-ol, 95%, 5,7-Dimethyl-1,8-naphthyridin-2(1H)-one, 95+%, 5,7-Dimethyl-1,8-naphthyridin-2-ol, 97%, 97%, 5,7-dimethyl-1,8-naphthyridin-2-ol, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 25g.
5,7-dimethyl-1H-1,8-naphthyridin-2-one (CAS 51420-71-4) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 5,7-dimethyl-1H-1,8-naphthyridin-2-one. InChIKey: MSEDGUHRFPAFFW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5,7-dimethyl-1H-1,8-naphthyridin-2-one |
| InChIKey | MSEDGUHRFPAFFW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC(=O)N2)C |
Computed by PubChem (NCBI)