CAS 515-20-8 appears in our catalog under these names: beta-Costol, β-Costol. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 2,5mg, 5mg, 10mg, 25mg, 50mg.
2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-en-1-ol (CAS 515-20-8) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-en-1-ol. InChIKey: FKWGZOFNSIESOX-QLFBSQMISA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-en-1-ol |
| InChIKey | FKWGZOFNSIESOX-QLFBSQMISA-N |
| SMILES | C[C@]12CCCC(=C)[C@@H]1C[C@@H](CC2)C(=C)CO |
Computed by PubChem (NCBI)