Products 51512-09-5
CAS 51512-09-5 appears in our catalog under these names: 2-Chlorophenylacetyl chloride, 97%, 2–Chlorophenylacetyl Chloride, 2-Chlorophenylacetyl Chloride, >98.0%(GC)(T), 2-Chlorophenylacetyl Chloride, 98%(GC),RG, 98%(GC),RG, 2-Chlorophenylacetyl chloride, 95%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Chemat. Available pack sizes: 5g, 25g, 100g, 250mg, 1g.
2-(2-chlorophenyl)acetyl chloride (CAS 51512-09-5) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 2-(2-chlorophenyl)acetyl chloride. InChIKey: WIHSAOYVGKVRJX-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2-(2-chlorophenyl)acetyl chloride |
| InChIKey | WIHSAOYVGKVRJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(2-chlorophenyl)acetyl Chloride, Acetyl chloride, 2-(2-chlorophenyl)-, o-chlorophenylacetyl chloride, (2-chlorophenyl)acetyl chloride, 2-Chlorophenylacetyl Chloride (stabilized with Copper chip), Benzeneacetyl chloride, 2-chloro-, o-Chlor-phenylacetylchlorid, o-chloro-phenylacetyl chloride, 2-chloro-phenylacetyl chloride, 2-chlorophenyl-acetyl chloride