Products 51517-59-0
CAS 51517-59-0 is the registry number for D-Glucose-d1-2, 99.92%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 100 mg, 10 mg.
(3R,4S,5S,6R)-3-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (CAS 51517-59-0) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.16 g/mol. IUPAC name: (3R,4S,5S,6R)-3-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-CUCXIZKQSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | (3R,4S,5S,6R)-3-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-CUCXIZKQSA-N |
| SMILES | [2H][C@]1([C@H]([C@@H]([C@H](OC1O)CO)O)O)O |
Computed by PubChem (NCBI)