CAS 51615-30-6 appears in our catalog under these names: Pregabalin Impurity 90, Pregabalin Impurity 184, Diethyl 2-(3-methylbutylidene)malonate, 97%, Pregabalin Impurity 83, Diethyl 2-(3-Methylbutylidene)malonate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Diethyl 2-(3-methylbutylidene)propanedioate (CAS 51615-30-6) is a chemical compound with the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. IUPAC name: diethyl 2-(3-methylbutylidene)propanedioate. InChIKey: WSMCGEUISONHKL-UHFFFAOYSA-N.
| Molecular formula | C12H20O4 |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | diethyl 2-(3-methylbutylidene)propanedioate |
| InChIKey | WSMCGEUISONHKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CCC(C)C)C(=O)OCC |
Computed by PubChem (NCBI)