Products 5162-01-6
CAS 5162-01-6 appears in our catalog under these names: (Rac)-Arnebin 1, 99.88%, 1-(5,8-Dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl 3-methylbut-2-enoate. Offered by: MedChemExpress, Chemat. Available pack sizes: 10mM/1mL, 5 mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-methylbut-2-enoate (CAS 5162-01-6) is a chemical compound with the molecular formula C21H22O6 and a molecular weight of 370.4 g/mol. IUPAC name: [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-methylbut-2-enoate. InChIKey: BATBOVZTQBLKIL-UHFFFAOYSA-N.
| Molecular formula | C21H22O6 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-methylbut-2-enoate |
| InChIKey | BATBOVZTQBLKIL-UHFFFAOYSA-N |
| SMILES | CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)OC(=O)C=C(C)C)C |
Computed by PubChem (NCBI)