Products 5164-32-9
CAS 5164-32-9 is the registry number for norpinane-3,3-dicarboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Bicyclo[3.1.1]heptane-3,3-dicarboxylic acid (CAS 5164-32-9) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: bicyclo[3.1.1]heptane-3,3-dicarboxylic acid. InChIKey: NGXQMCXOIGSTNL-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | bicyclo[3.1.1]heptane-3,3-dicarboxylic acid |
| InChIKey | NGXQMCXOIGSTNL-UHFFFAOYSA-N |
| SMILES | C1C2CC1CC(C2)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)