CAS 51671-69-3 is the registry number for 2-Methoxy-4-methylbenzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-4-methylbenzoyl chloride (CAS 51671-69-3) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 2-methoxy-4-methylbenzoyl chloride. InChIKey: ZXHHHBPLVWGPPX-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-methoxy-4-methylbenzoyl chloride |
| InChIKey | ZXHHHBPLVWGPPX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)Cl)OC |
Computed by PubChem (NCBI)