Products 51671-69-3

CAS 51671-69-3 is the registry number for 2-Methoxy-4-methylbenzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methoxy-4-methylbenzoyl chloride (CAS 51671-69-3) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 2-methoxy-4-methylbenzoyl chloride. InChIKey: ZXHHHBPLVWGPPX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO2
Molecular weight184.62 g/mol
IUPAC name2-methoxy-4-methylbenzoyl chloride
InChIKeyZXHHHBPLVWGPPX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C(=O)Cl)OC

Computed by PubChem (NCBI)