CAS 517-07-7 appears in our catalog under these names: Equilenin Impurity 11, Hexahydroequilenin. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(3S,13S,14S,17S)-13-methyl-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 517-07-7) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 272.4 g/mol. IUPAC name: (3S,13S,14S,17S)-13-methyl-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: FHUJXHJKJMSASV-JUKXBJQTSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (3S,13S,14S,17S)-13-methyl-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | FHUJXHJKJMSASV-JUKXBJQTSA-N |
| SMILES | C[C@]12CCC3=C([C@@H]1CC[C@@H]2O)C=CC4=C3CC[C@@H](C4)O |
Computed by PubChem (NCBI)