Products 51724-52-8
CAS 51724-52-8 is the registry number for Dechlorflavonin. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-2-(2-hydroxyphenyl)-3,7,8-trimethoxychromen-4-one (CAS 51724-52-8) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: 5-hydroxy-2-(2-hydroxyphenyl)-3,7,8-trimethoxychromen-4-one. InChIKey: SSSCWLSFMYTPNY-UHFFFAOYSA-N.
| Molecular formula | C18H16O7 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 5-hydroxy-2-(2-hydroxyphenyl)-3,7,8-trimethoxychromen-4-one |
| InChIKey | SSSCWLSFMYTPNY-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C(=C1)O)C(=O)C(=C(O2)C3=CC=CC=C3O)OC)OC |
Computed by PubChem (NCBI)