CAS 51762-93-7 is the registry number for 9-Oxo-9h-thioxanthene-3-carboxamide 10,10-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
9,10,10-trioxothioxanthene-3-carboxamide (CAS 51762-93-7) is a chemical compound with the molecular formula C14H9NO4S and a molecular weight of 287.29 g/mol. IUPAC name: 9,10,10-trioxothioxanthene-3-carboxamide. InChIKey: NECFGXHWUOZZSE-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | 9,10,10-trioxothioxanthene-3-carboxamide |
| InChIKey | NECFGXHWUOZZSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2(=O)=O)C=C(C=C3)C(=O)N |
Computed by PubChem (NCBI)