CAS 55211-73-9 appears in our catalog under these names: 2-(4-Nitrophenyl)-4h-3,1-benzoxathiin-4-one, 95%, 2-(4-Nitrophenyl)-4H-benzo(d)(1,3)oxathiin-4-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-nitrophenyl)-3,1-benzoxathiin-4-one (CAS 55211-73-9) is a chemical compound with the molecular formula C14H9NO4S and a molecular weight of 287.29 g/mol. IUPAC name: 2-(4-nitrophenyl)-3,1-benzoxathiin-4-one. InChIKey: JGPYSTGKMNQEJQ-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-3,1-benzoxathiin-4-one |
| InChIKey | JGPYSTGKMNQEJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC(S2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)