CAS 602307-19-7 is the registry number for 1,3-Dioxoisoindolin-2-yl 2-(thiophen-3-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate (CAS 602307-19-7) is a chemical compound with the molecular formula C14H9NO4S and a molecular weight of 287.29 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate. InChIKey: AKVMELQJKYJBQM-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate |
| InChIKey | AKVMELQJKYJBQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OC(=O)CC3=CSC=C3 |
Computed by PubChem (NCBI)