Products 518292-58-5
CAS 518292-58-5 appears in our catalog under these names: 9,10–Dibromoanthracene–d8, 9,10-Dibromoanthracene-d8, 99.2%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 10 g, 5 g, 1 g.
9,10-dibromo-1,2,3,4,5,6,7,8-octadeuterioanthracene (CAS 518292-58-5) is a chemical compound with the molecular formula C14H8Br2 and a molecular weight of 344.07 g/mol. IUPAC name: 9,10-dibromo-1,2,3,4,5,6,7,8-octadeuterioanthracene. InChIKey: BRUOAURMAFDGLP-PGRXLJNUSA-N.
| Molecular formula | C14H8Br2 |
|---|---|
| Molecular weight | 344.07 g/mol |
| IUPAC name | 9,10-dibromo-1,2,3,4,5,6,7,8-octadeuterioanthracene |
| InChIKey | BRUOAURMAFDGLP-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(=C(C(=C(C3=C2Br)[2H])[2H])[2H])[2H])Br)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
9,10-Dibromoanthracene-d8, orb3027570