CAS 519-05-1 appears in our catalog under these names: 2-Carboxy-3,4-dimethoxybenzaldehyde, min. 95 %, 1 g, 6-Formyl-2,3-dimethoxybenzoic acid, 95%, Noscapine Impurity 5 (Opianic Acid) (Mixture of Tautomeric Isomers), Opianic Acid, >95% (HPLC), 6-Formyl-2,3-dimethoxybenzoic acid, ≥98%, ≥98%. Offered by: Roth, Combi-blocks, Chemat Brand, TRC, Chemat. Available pack sizes: 1g, 5g, on request, 100mg, 50mg, 250mg, 2g, 10g.
6-formyl-2,3-dimethoxybenzoic acid (CAS 519-05-1) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 6-formyl-2,3-dimethoxybenzoic acid. InChIKey: HVXXOIGTXJOVON-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 6-formyl-2,3-dimethoxybenzoic acid |
| InChIKey | HVXXOIGTXJOVON-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)C(=O)O)OC |
Computed by PubChem (NCBI)