CAS 519018-52-1 appears in our catalog under these names: 7-Bromobenzofuran-3(2H)-one 98%, 7-Bromo-3(2H)-benzofuranone, 98%, 98%, 7-Bromo-3-benzofuranone, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
7-bromo-1-benzofuran-3-one (CAS 519018-52-1) is a chemical compound with the molecular formula C8H5BrO2 and a molecular weight of 213.03 g/mol. IUPAC name: 7-bromo-1-benzofuran-3-one. InChIKey: MGCVLLXCJNKGCS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO2 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 7-bromo-1-benzofuran-3-one |
| InChIKey | MGCVLLXCJNKGCS-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C(=CC=C2)Br |
Computed by PubChem (NCBI)