CAS 519151-74-7 appears in our catalog under these names: 1-(4-Fluoro-phenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%, 1-(4-Fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid (CAS 519151-74-7) is a chemical compound with the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: UHSNGSYVRLIXCX-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO2 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| InChIKey | UHSNGSYVRLIXCX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)F)C)C(=O)O |
Computed by PubChem (NCBI)