CAS 891764-80-0 appears in our catalog under these names: 5-(4-Fluorophenyl)-1,2-dimethyl-1h-pyrrole-3-carboxylic acid, 95%, 5-(4-Fluorophenyl)-1,2-dimethyl-1H-pyrrole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.
5-(4-fluorophenyl)-1,2-dimethylpyrrole-3-carboxylic acid (CAS 891764-80-0) is a chemical compound with the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-dimethylpyrrole-3-carboxylic acid. InChIKey: OAKQOMKKKBNYCI-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO2 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-dimethylpyrrole-3-carboxylic acid |
| InChIKey | OAKQOMKKKBNYCI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1C)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)