CAS 923781-31-1 is the registry number for 1-(2-Fluorophenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid (CAS 923781-31-1) is a chemical compound with the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. IUPAC name: 1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: AZLZPSZPXDJCDU-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO2 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| InChIKey | AZLZPSZPXDJCDU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC=C2F)C)C(=O)O |
Computed by PubChem (NCBI)