Products 51926-52-4

CAS 51926-52-4 appears in our catalog under these names: H–D–Phe–Pro–OH, H-D-Phe-Pro-OH Trifluoroacetate Salt. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 0,25g, 0,5g.

Structural formula: {0} (CAS {1})

(2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 51926-52-4) is a chemical compound with the molecular formula C14H18N2O3 and a molecular weight of 262.30 g/mol. IUPAC name: (2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: WEQJQNWXCSUVMA-NEPJUHHUSA-N.

Identity
Molecular formulaC14H18N2O3
Molecular weight262.30 g/mol
IUPAC name(2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid
InChIKeyWEQJQNWXCSUVMA-NEPJUHHUSA-N
SMILESC1C[C@H](N(C1)C(=O)[C@@H](CC2=CC=CC=C2)N)C(=O)O

Computed by PubChem (NCBI)