Products 51964-30-8
CAS 51964-30-8 is the registry number for 1,3-Phenylenedimethanamine dihydrochloride, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[3-(aminomethyl)phenyl]methanamine;dihydrochloride (CAS 51964-30-8) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: [3-(aminomethyl)phenyl]methanamine;dihydrochloride. InChIKey: TZQKBVRYFWPVEQ-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | [3-(aminomethyl)phenyl]methanamine;dihydrochloride |
| InChIKey | TZQKBVRYFWPVEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)CN)CN.Cl.Cl |
Computed by PubChem (NCBI)