CAS 51988-36-4 appears in our catalog under these names: 3-(propionyloxy)benzoic acid, min. 90 %, 100 mg, 3-(Propionyloxy)benzoic acid, 95%, 3–(Propionyloxy)benzoic acid, 3-(propionyloxy)benzoic acid, 3-(propionyloxy)benzoic acid, min. 90 %, 50 mg. Offered by: Roth, Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 5g, 1g, 250mg, 500mg, 50mg, 1000mg.
3-propanoyloxybenzoic acid (CAS 51988-36-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3-propanoyloxybenzoic acid. InChIKey: KDSHSYUJJSWWNU-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-propanoyloxybenzoic acid |
| InChIKey | KDSHSYUJJSWWNU-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)