CAS 520-79-6 appears in our catalog under these names: 2-Hydroxy-3-iodobenzoic acid, 97%, 2-Hydroxy-3-iodobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-hydroxy-3-iodobenzoic acid (CAS 520-79-6) is a chemical compound with the molecular formula C7H5IO3 and a molecular weight of 264.02 g/mol. IUPAC name: 2-hydroxy-3-iodobenzoic acid. InChIKey: PJLHEOAOXSHXLR-UHFFFAOYSA-N.
| Molecular formula | C7H5IO3 |
|---|---|
| Molecular weight | 264.02 g/mol |
| IUPAC name | 2-hydroxy-3-iodobenzoic acid |
| InChIKey | PJLHEOAOXSHXLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)O)C(=O)O |
Computed by PubChem (NCBI)