Products 879898-76-7

CAS 879898-76-7 is the registry number for 2,5-Dihydroxy-4-iodobenzaldehyde 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2,5-dihydroxy-4-iodobenzaldehyde (CAS 879898-76-7) is a chemical compound with the molecular formula C7H5IO3 and a molecular weight of 264.02 g/mol. IUPAC name: 2,5-dihydroxy-4-iodobenzaldehyde. InChIKey: MYDVKFHBVCKLJT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5IO3
Molecular weight264.02 g/mol
IUPAC name2,5-dihydroxy-4-iodobenzaldehyde
InChIKeyMYDVKFHBVCKLJT-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1O)I)O)C=O

Computed by PubChem (NCBI)