CAS 75821-44-2 appears in our catalog under these names: 3–Hydroxy–2–iodobenzoic acid, 3-Hydroxy-2-iodobenzoic acid, 98%, 3-Hydroxy-2-iodobenzoic acid, 98%, 98%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
3-hydroxy-2-iodobenzoic acid (CAS 75821-44-2) is a chemical compound with the molecular formula C7H5IO3 and a molecular weight of 264.02 g/mol. IUPAC name: 3-hydroxy-2-iodobenzoic acid. InChIKey: YCPLPINFTMFQTD-UHFFFAOYSA-N.
| Molecular formula | C7H5IO3 |
|---|---|
| Molecular weight | 264.02 g/mol |
| IUPAC name | 3-hydroxy-2-iodobenzoic acid |
| InChIKey | YCPLPINFTMFQTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)I)C(=O)O |
Computed by PubChem (NCBI)