CAS 52084-13-6 appears in our catalog under these names: H–Val–pNA, L-Valine p-nitroanilide. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1g, 5g, Get quote.
(2S)-2-amino-3-methyl-N-(4-nitrophenyl)butanamide (CAS 52084-13-6) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-amino-3-methyl-N-(4-nitrophenyl)butanamide. InChIKey: IFIZCLBWDPSXDM-JTQLQIEISA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-amino-3-methyl-N-(4-nitrophenyl)butanamide |
| InChIKey | IFIZCLBWDPSXDM-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)