Products 52221-09-7

CAS 52221-09-7 is the registry number for tert-Butyl ethyl adipate, 95%. Offered by: AmBeed. Available pack sizes: 5g.

6-O-tert-butyl 1-O-ethyl hexanedioate (CAS 52221-09-7) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: 6-O-tert-butyl 1-O-ethyl hexanedioate. InChIKey: IHYVVOREXNPPGV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22O4
Molecular weight230.30 g/mol
IUPAC name6-O-tert-butyl 1-O-ethyl hexanedioate
InChIKeyIHYVVOREXNPPGV-UHFFFAOYSA-N
SMILESCCOC(=O)CCCCC(=O)OC(C)(C)C

Computed by PubChem (NCBI)