CAS 5228-49-9 appears in our catalog under these names: 1–methyl–5–nitro–1H–indazole, 1-Methyl-5-nitro-1H-indazole 97%, 1H-Indazole, 1-methyl-5-nitro-, 97%, 97%, 5-Nitro-1-methyl-1H-indazole, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100g.
1-methyl-5-nitroindazole (CAS 5228-49-9) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 1-methyl-5-nitroindazole. InChIKey: JHPMRMBDPINHAV-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-methyl-5-nitroindazole |
| InChIKey | JHPMRMBDPINHAV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)[N+](=O)[O-])C=N1 |
Computed by PubChem (NCBI)