CAS 5228-50-2 is the registry number for 2-Ethyl-5-nitroindazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-ethyl-5-nitroindazole (CAS 5228-50-2) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-ethyl-5-nitroindazole. InChIKey: USHQCKGUIXULLT-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-ethyl-5-nitroindazole |
| InChIKey | USHQCKGUIXULLT-UHFFFAOYSA-N |
| SMILES | CCN1C=C2C=C(C=CC2=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)