CAS 5228-51-3 appears in our catalog under these names: 1–Ethyl–5–nitro–1H–indazole, 1-Ethyl-5-nitro-1H-indazole 98%, 1-Ethyl-5-nitroindazole, 98%, 98%, 1-Ethyl-5-nitro-1H-indazole, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-ethyl-5-nitroindazole (CAS 5228-51-3) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 1-ethyl-5-nitroindazole. InChIKey: OMCQGSFMKUKHLW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 1-ethyl-5-nitroindazole |
| InChIKey | OMCQGSFMKUKHLW-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)[N+](=O)[O-])C=N1 |
Computed by PubChem (NCBI)