CAS 52305-68-7 is the registry number for 1-Phenylcyclohexane-1,2-diol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-phenylcyclohexane-1,2-diol (CAS 52305-68-7) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-phenylcyclohexane-1,2-diol. InChIKey: QHNHEYDAIICUDL-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-phenylcyclohexane-1,2-diol |
| InChIKey | QHNHEYDAIICUDL-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)O)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)