CAS 52331-74-5 appears in our catalog under these names: 2-Thiophen-2-yl-benzooxazol-5-ylamine, 2-Thiophen-2-yl-benzooxazol-5-ylamine, 95+%, 2-(Thiophen-2-yl)-1,3-benzoxazol-5-amine. Offered by: Fluorochem, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
2-thiophen-2-yl-1,3-benzoxazol-5-amine (CAS 52331-74-5) is a chemical compound with the molecular formula C11H8N2OS and a molecular weight of 216.26 g/mol. IUPAC name: 2-thiophen-2-yl-1,3-benzoxazol-5-amine. InChIKey: ZRSQBVAYYVOKFY-UHFFFAOYSA-N.
| Molecular formula | C11H8N2OS |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-thiophen-2-yl-1,3-benzoxazol-5-amine |
| InChIKey | ZRSQBVAYYVOKFY-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)