CAS 932365-96-3 is the registry number for 2-(Cyanosulfanyl)-1-(1H-indol-3-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2-(1H-indol-3-yl)-2-oxoethyl] thiocyanate (CAS 932365-96-3) is a chemical compound with the molecular formula C11H8N2OS and a molecular weight of 216.26 g/mol. IUPAC name: [2-(1H-indol-3-yl)-2-oxoethyl] thiocyanate. InChIKey: MDNHLLQPPYPBBL-UHFFFAOYSA-N.
| Molecular formula | C11H8N2OS |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | [2-(1H-indol-3-yl)-2-oxoethyl] thiocyanate |
| InChIKey | MDNHLLQPPYPBBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)CSC#N |
Computed by PubChem (NCBI)