Products 52387-15-2
CAS 52387-15-2 is the registry number for (2-Methylbutyryl)shikonin. Offered by: MedChemExpress. Available pack sizes: Get quote.
[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-methylbutanoate (CAS 52387-15-2) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-methylbutanoate. InChIKey: ODQATBANLZCROD-UHFFFAOYSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-methylbutanoate |
| InChIKey | ODQATBANLZCROD-UHFFFAOYSA-N |
| SMILES | CCC(C)C(=O)OC(CC=C(C)C)C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O |
Computed by PubChem (NCBI)