CAS 52431-65-9 is the registry number for 2-Bromo-8-hydroxynaphthalene-1,4-dione 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-8-hydroxynaphthalene-1,4-dione (CAS 52431-65-9) is a chemical compound with the molecular formula C10H5BrO3 and a molecular weight of 253.05 g/mol. IUPAC name: 2-bromo-8-hydroxynaphthalene-1,4-dione. InChIKey: QQUYEYJPZLCULC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO3 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 2-bromo-8-hydroxynaphthalene-1,4-dione |
| InChIKey | QQUYEYJPZLCULC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C(=CC2=O)Br |
Computed by PubChem (NCBI)