CAS 52817-12-6 appears in our catalog under these names: 6-Bromo-3-formylchromone, 98%, 6-Bromo-3-formylchromone, 97% , 6-BROMO-3-FORMYLCHROMONE, 99%, 6-Bromo-3-formylchromone, 97%, 6-Bromo-3-formylchromone, >97.0%(GC). Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Fluorochem, TCI. Available pack sizes: 25g, 100g, 5g, 1g, 10g, 250mg.
6-bromo-4-oxochromene-3-carbaldehyde (CAS 52817-12-6) is a chemical compound with the molecular formula C10H5BrO3 and a molecular weight of 253.05 g/mol. IUPAC name: 6-bromo-4-oxochromene-3-carbaldehyde. InChIKey: PCEZXSJBHMOQFT-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO3 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 6-bromo-4-oxochromene-3-carbaldehyde |
| InChIKey | PCEZXSJBHMOQFT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=CO2)C=O |
Computed by PubChem (NCBI)